C17H13F2N3O2 — CID 71680128
ethyl 8-amino-2-(3,5-difluorophenyl)-1,7-naphthyridine-5-carboxylate (PubChem CID 71680128) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is ethyl 8-amino-2-(3,5-difluorophenyl)-1,7-naphthyridine-5-carboxylate.
| Compound Name | ethyl 8-amino-2-(3,5-difluorophenyl)-1,7-naphthyridine-5-carboxylate |
|---|---|
| PubChem CID | 71680128 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | ethyl 8-amino-2-(3,5-difluorophenyl)-1,7-naphthyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(N)c2nc(-c3cc(F)cc(F)c3)ccc12 |
| InChI | InChI=1S/C17H13F2N3O2/c1-2-24-17(23)13-8-21-16(20)15-12(13)3-4-14(22-15)9-5-10(18)7-11(19)6-9/h3-8H,2H2,1H3,(H2,20,21) |
| InChIKey | VOPBRERWBAZBNN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |