C28H33N3O12S — CID 71680598
2-amino-5-[[1-(carboxymethylamino)-3-(1,2-dihydroxy-3,5,6,7-tetramethoxyphenanthren-4-yl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 71680598) has the molecular formula C28H33N3O12S and a molecular weight of 635.65 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-3-(1,2-dihydroxy-3,5,6,7-tetramethoxyphenanthren-4-yl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-3-(1,2-dihydroxy-3,5,6,7-tetramethoxyphenanthren-4-yl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71680598 |
| Molecular Formula | C28H33N3O12S |
| Molecular Weight | 635.65 g/mol |
| Exact Mass | 635.18 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-3-(1,2-dihydroxy-3,5,6,7-tetramethoxyphenanthren-4-yl)sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | COc1cc2ccc3c(O)c(O)c(OC)c(SCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)c3c2c(OC)c1OC |
| InChI | InChI=1S/C28H33N3O12S/c1-40-16-9-12-5-6-13-20(19(12)24(42-3)23(16)41-2)26(25(43-4)22(36)21(13)35)44-11-15(27(37)30-10-18(33)34)31-17(32)8-7-14(29)28(38)39/h5-6,9,14-15,35-36H,7-8,10-11,29H2,1-4H3,(H,30,37)(H,31,32)(H,33,34)(H,38,39) |
| InChIKey | OEFYTTQFBUCKIS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 236.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|