C32H55IO5Si — CID 71681607
[(1E,3R)-1-iodohexa-1,5-dien-3-yl] 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 71681607) has the molecular formula C32H55IO5Si and a molecular weight of 674.78 g/mol. Its IUPAC name is [(1E,3R)-1-iodohexa-1,5-dien-3-yl] 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | [(1E,3R)-1-iodohexa-1,5-dien-3-yl] 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 71681607 |
| Molecular Formula | C32H55IO5Si |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | [(1E,3R)-1-iodohexa-1,5-dien-3-yl] 2-[(2S,4R,6S)-6-[[(2S,6R)-6-but-3-enyloxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | C=CCC[C@H]1CCC[C@@H](C[C@H]2C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H](CC(=O)O[C@@H](/C=C/I)CC=C)O2)O1 |
| InChI | InChI=1S/C32H55IO5Si/c1-9-11-14-27-15-12-16-28(35-27)19-29-20-31(38-39(23(3)4,24(5)6)25(7)8)21-30(36-29)22-32(34)37-26(13-10-2)17-18-33/h9-10,17-18,23-31H,1-2,11-16,19-22H2,3-8H3/b18-17+/t26-,27+,28+,29+,30+,31-/m1/s1 |
| InChIKey | RHSPDEYHMUSDIQ-BDSMTXNQSA-N |
| XLogP | 9.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|