C28H26N4O4 — CID 71682110
methyl 9-(furan-2-ylmethyl)-19-oxo-20-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate (PubChem CID 71682110) has the molecular formula C28H26N4O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is methyl 9-(furan-2-ylmethyl)-19-oxo-20-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate.
| Compound Name | methyl 9-(furan-2-ylmethyl)-19-oxo-20-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate |
|---|---|
| PubChem CID | 71682110 |
| Molecular Formula | C28H26N4O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl 9-(furan-2-ylmethyl)-19-oxo-20-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate |
| SMILES | CCCCCn1c(=O)c2ccccc2c2nc3n(Cc4ccco4)c4ccc(C(=O)OC)cc4n3c21 |
| InChI | InChI=1S/C28H26N4O4/c1-3-4-7-14-30-25-24(20-10-5-6-11-21(20)26(30)33)29-28-31(17-19-9-8-15-36-19)22-13-12-18(27(34)35-2)16-23(22)32(25)28/h5-6,8-13,15-16H,3-4,7,14,17H2,1-2H3 |
| InChIKey | JIOJOARWMSLXDL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|