C30H28N4O3 — CID 71681458
methyl 20-benzyl-19-oxo-9-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate (PubChem CID 71681458) has the molecular formula C30H28N4O3 and a molecular weight of 492.58 g/mol. Its IUPAC name is methyl 20-benzyl-19-oxo-9-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate.
| Compound Name | methyl 20-benzyl-19-oxo-9-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate |
|---|---|
| PubChem CID | 71681458 |
| Molecular Formula | C30H28N4O3 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | methyl 20-benzyl-19-oxo-9-pentyl-2,9,11,20-tetrazapentacyclo[10.8.0.02,10.03,8.013,18]icosa-1(12),3(8),4,6,10,13,15,17-octaene-5-carboxylate |
| SMILES | CCCCCn1c2ccc(C(=O)OC)cc2n2c3c(nc12)c1ccccc1c(=O)n3Cc1ccccc1 |
| InChI | InChI=1S/C30H28N4O3/c1-3-4-10-17-32-24-16-15-21(29(36)37-2)18-25(24)34-27-26(31-30(32)34)22-13-8-9-14-23(22)28(35)33(27)19-20-11-6-5-7-12-20/h5-9,11-16,18H,3-4,10,17,19H2,1-2H3 |
| InChIKey | QZSGBQZKVWWXDU-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|