C21H27NO3S2 — CID 7168309
2-ethylsulfanylethyl (4S)-2,7,7-trimethyl-5-oxo-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 7168309) has the molecular formula C21H27NO3S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4S)-2,7,7-trimethyl-5-oxo-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4S)-2,7,7-trimethyl-5-oxo-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7168309 |
| Molecular Formula | C21H27NO3S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2-ethylsulfanylethyl (4S)-2,7,7-trimethyl-5-oxo-4-thiophen-2-yl-3,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCSCCOC(=O)C1C(C)=NC2=C(C(=O)CC(C)(C)C2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C21H27NO3S2/c1-5-26-10-8-25-20(24)17-13(2)22-14-11-21(3,4)12-15(23)18(14)19(17)16-7-6-9-27-16/h6-7,9,17,19H,5,8,10-12H2,1-4H3/t17?,19-/m0/s1 |
| InChIKey | MNKOLOLHPUQJSO-NNBQYGFHSA-N |
| XLogP | 4.86 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|