C19H23NO3S2 — CID 7106193
2-ethylsulfanylethyl (4R)-2-methyl-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7106193) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-ethylsulfanylethyl (4R)-2-methyl-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl (4R)-2-methyl-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7106193 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-ethylsulfanylethyl (4R)-2-methyl-5-oxo-4-thiophen-3-yl-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCSCCOC(=O)C1C(C)=NC2=C(C(=O)CCC2)[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C19H23NO3S2/c1-3-24-10-8-23-19(22)16-12(2)20-14-5-4-6-15(21)18(14)17(16)13-7-9-25-11-13/h7,9,11,16-17H,3-6,8,10H2,1-2H3/t16?,17-/m1/s1 |
| InChIKey | APZRYTUNEJNPNU-ZYMOGRSISA-N |
| XLogP | 4.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|