C21H24INO4 — CID 7230293
2-ethoxyethyl (4R)-4-(4-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate (PubChem CID 7230293) has the molecular formula C21H24INO4 and a molecular weight of 481.33 g/mol. Its IUPAC name is 2-ethoxyethyl (4R)-4-(4-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4R)-4-(4-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 7230293 |
| Molecular Formula | C21H24INO4 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-ethoxyethyl (4R)-4-(4-iodophenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-3H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1C(C)=NC2=C(C(=O)CCC2)[C@H]1c1ccc(I)cc1 |
| InChI | InChI=1S/C21H24INO4/c1-3-26-11-12-27-21(25)18-13(2)23-16-5-4-6-17(24)20(16)19(18)14-7-9-15(22)10-8-14/h7-10,18-19H,3-6,11-12H2,1-2H3/t18?,19-/m0/s1 |
| InChIKey | NBFWOXZWMSUIQD-GGYWPGCISA-N |
| XLogP | 4.05 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|