C16H16N2O4 — CID 71683659
ethyl 4-[[2-(2-formylpyrrol-1-yl)acetyl]amino]benzoate (PubChem CID 71683659) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is ethyl 4-[[2-(2-formylpyrrol-1-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2-formylpyrrol-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 71683659 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | ethyl 4-[[2-(2-formylpyrrol-1-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2cccc2C=O)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-2-22-16(21)12-5-7-13(8-6-12)17-15(20)10-18-9-3-4-14(18)11-19/h3-9,11H,2,10H2,1H3,(H,17,20) |
| InChIKey | JFYJAVAUFLQWMK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|