C16H25F3N4 — CID 71684743
N-(3-ethyl-2-pyrrolidin-1-ylpentyl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 71684743) has the molecular formula C16H25F3N4 and a molecular weight of 330.40 g/mol. Its IUPAC name is N-(3-ethyl-2-pyrrolidin-1-ylpentyl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(3-ethyl-2-pyrrolidin-1-ylpentyl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 71684743 |
| Molecular Formula | C16H25F3N4 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | N-(3-ethyl-2-pyrrolidin-1-ylpentyl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCC(CC)C(CNc1nccc(C(F)(F)F)n1)N1CCCC1 |
| InChI | InChI=1S/C16H25F3N4/c1-3-12(4-2)13(23-9-5-6-10-23)11-21-15-20-8-7-14(22-15)16(17,18)19/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,20,21,22) |
| InChIKey | HLVLCBBHMUUALT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |