C25H22F3N3O3 — CID 71685503
3-[(2-benzamido-2-phenylacetyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 71685503) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is 3-[(2-benzamido-2-phenylacetyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[(2-benzamido-2-phenylacetyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 71685503 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-[(2-benzamido-2-phenylacetyl)amino]-4-methyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(C(=O)NCC(F)(F)F)cc1NC(=O)C(NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22F3N3O3/c1-16-12-13-19(22(32)29-15-25(26,27)28)14-20(16)30-24(34)21(17-8-4-2-5-9-17)31-23(33)18-10-6-3-7-11-18/h2-14,21H,15H2,1H3,(H,29,32)(H,30,34)(H,31,33) |
| InChIKey | VCFMETKYGXXQPL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |