About cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone
cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone (PubChem CID 71687066) has the molecular formula C22H32N2O2
and a molecular weight of 356.51 g/mol. Its IUPAC name is cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
| PubChem CID | 71687066 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CC[C@](O)(c2ccccc2)[C@H](N2CCCC2)C1 |
| InChI | InChI=1S/C22H32N2O2/c25-21(18-9-3-1-4-10-18)24-16-13-22(26,19-11-5-2-6-12-19)20(17-24)23-14-7-8-15-23/h2,5-6,11-12,18,20,26H,1,3-4,7-10,13-17H2/t20-,22+/m1/s1 |
| InChIKey | VWOAGDDAWZWWOK-IRLDBZIGSA-N |
| XLogP | 3.15 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The IUPAC name of cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone (CID 71687066) is cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone.
What is the SMILES notation for cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The canonical SMILES for cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone is O=C(C1CCCCC1)N1CC[C@](O)(c2ccccc2)[C@H](N2CCCC2)C1.
What is the InChIKey of cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
The InChIKey is VWOAGDDAWZWWOK-IRLDBZIGSA-N. The full InChI is InChI=1S/C22H32N2O2/c25-21(18-9-3-1-4-10-18)24-16-13-22(26,19-11-5-2-6-12-19)20(17-24)23-14-7-8-15-23/h2,5-6,11-12,18,20,26H,1,3-4,7-10,13-17H2/t20-,22+/m1/s1.
What are the key properties of cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone?
cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone has a molecular weight of 356.51 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[(3R,4S)-4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl]methanone is sourced from PubChem (CID 71687066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).