C20H24F2N2O4 — CID 71687462
methyl 8-[(3,5-difluorophenyl)methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate (PubChem CID 71687462) has the molecular formula C20H24F2N2O4 and a molecular weight of 394.42 g/mol. Its IUPAC name is methyl 8-[(3,5-difluorophenyl)methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate.
| Compound Name | methyl 8-[(3,5-difluorophenyl)methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 71687462 |
| Molecular Formula | C20H24F2N2O4 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | methyl 8-[(3,5-difluorophenyl)methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate |
| SMILES | C=CCON1C(=O)CC(C(=O)OC)C12CCN(Cc1cc(F)cc(F)c1)CC2 |
| InChI | InChI=1S/C20H24F2N2O4/c1-3-8-28-24-18(25)12-17(19(26)27-2)20(24)4-6-23(7-5-20)13-14-9-15(21)11-16(22)10-14/h3,9-11,17H,1,4-8,12-13H2,2H3 |
| InChIKey | HQCDDECHCWBUBW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|