C24H28N2O5 — CID 95716716
methyl (4R)-8-[[4-(furan-2-yl)phenyl]methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate (PubChem CID 95716716) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is methyl (4R)-8-[[4-(furan-2-yl)phenyl]methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate.
| Compound Name | methyl (4R)-8-[[4-(furan-2-yl)phenyl]methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 95716716 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | methyl (4R)-8-[[4-(furan-2-yl)phenyl]methyl]-2-oxo-1-prop-2-enoxy-1,8-diazaspiro[4.5]decane-4-carboxylate |
| SMILES | C=CCON1C(=O)C[C@@H](C(=O)OC)C12CCN(Cc1ccc(-c3ccco3)cc1)CC2 |
| InChI | InChI=1S/C24H28N2O5/c1-3-14-31-26-22(27)16-20(23(28)29-2)24(26)10-12-25(13-11-24)17-18-6-8-19(9-7-18)21-5-4-15-30-21/h3-9,15,20H,1,10-14,16-17H2,2H3/t20-/m0/s1 |
| InChIKey | SHVPMJMQXQFFBN-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|