C16H16N4O2S — CID 71688083
N-(2,4-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-sulfonamide (PubChem CID 71688083) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-sulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 71688083 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cnn(-c3ccccn3)c2)c(C)c1 |
| InChI | InChI=1S/C16H16N4O2S/c1-12-6-7-15(13(2)9-12)19-23(21,22)14-10-18-20(11-14)16-5-3-4-8-17-16/h3-11,19H,1-2H3 |
| InChIKey | ZCGKXXMBJQEZHI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |