C15H15N5OS — CID 71688676
N-(3-imidazol-1-ylpropyl)-5-phenylthiadiazole-4-carboxamide (PubChem CID 71688676) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-5-phenylthiadiazole-4-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-5-phenylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 71688676 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-5-phenylthiadiazole-4-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1nnsc1-c1ccccc1 |
| InChI | InChI=1S/C15H15N5OS/c21-15(17-7-4-9-20-10-8-16-11-20)13-14(22-19-18-13)12-5-2-1-3-6-12/h1-3,5-6,8,10-11H,4,7,9H2,(H,17,21) |
| InChIKey | SSAVYQDJZCPMKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|