C14H18N4OS — CID 71688668
N-[3-(dimethylamino)propyl]-5-phenylthiadiazole-4-carboxamide (PubChem CID 71688668) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-5-phenylthiadiazole-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-5-phenylthiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 71688668 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-5-phenylthiadiazole-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1nnsc1-c1ccccc1 |
| InChI | InChI=1S/C14H18N4OS/c1-18(2)10-6-9-15-14(19)12-13(20-17-16-12)11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3,(H,15,19) |
| InChIKey | OKFFSCVVMQJFED-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|