C20H18ClN3O2S — CID 7168878
3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-phenyl-4-prop-2-enyl-1,2,4-triazole (PubChem CID 7168878) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-phenyl-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-phenyl-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 7168878 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 3-[(6-chloro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-5-phenyl-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cc(Cl)cc3c2OCOC3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H18ClN3O2S/c1-2-8-24-19(14-6-4-3-5-7-14)22-23-20(24)27-12-16-10-17(21)9-15-11-25-13-26-18(15)16/h2-7,9-10H,1,8,11-13H2 |
| InChIKey | VIWBGXKKHMTKQM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|