C20H17ClN4O4S — CID 112770609
3-(3-chlorophenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole (PubChem CID 112770609) has the molecular formula C20H17ClN4O4S and a molecular weight of 444.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole.
| Compound Name | 3-(3-chlorophenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112770609 |
| Molecular Formula | C20H17ClN4O4S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 3-(3-chlorophenyl)-5-[(6-nitro-4H-1,3-benzodioxin-8-yl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazole |
| SMILES | C=CCn1c(SCc2cc([N+](=O)[O-])cc3c2OCOC3)nnc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H17ClN4O4S/c1-2-6-24-19(13-4-3-5-16(21)7-13)22-23-20(24)30-11-15-9-17(25(26)27)8-14-10-28-12-29-18(14)15/h2-5,7-9H,1,6,10-12H2 |
| InChIKey | GPDKZLLVJYMFIK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|