C18H19F3N2O4 — CID 71693995
N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 71693995) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 71693995 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-[6-(trifluoromethyl)-3-pyridinyl]cyclopentyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2[C@H](O)[C@H](O)C[C@@H]2c2ccc(C(F)(F)F)nc2)c(C)o1 |
| InChI | InChI=1S/C18H19F3N2O4/c1-8-5-11(9(2)27-8)17(26)23-15-12(6-13(24)16(15)25)10-3-4-14(22-7-10)18(19,20)21/h3-5,7,12-13,15-16,24-25H,6H2,1-2H3,(H,23,26)/t12-,13-,15-,16-/m1/s1 |
| InChIKey | HOCJWKXOQLMRNP-RRCSTGOVSA-N |
| XLogP | 2.32 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |