C15H11ClFN3O2 — CID 71694719
N-(4-chloro-2-fluorophenyl)-5-methoxy-1H-indazole-7-carboxamide (PubChem CID 71694719) has the molecular formula C15H11ClFN3O2 and a molecular weight of 319.72 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-5-methoxy-1H-indazole-7-carboxamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-5-methoxy-1H-indazole-7-carboxamide |
|---|---|
| PubChem CID | 71694719 |
| Molecular Formula | C15H11ClFN3O2 |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-5-methoxy-1H-indazole-7-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Cl)cc2F)c2[nH]ncc2c1 |
| InChI | InChI=1S/C15H11ClFN3O2/c1-22-10-4-8-7-18-20-14(8)11(6-10)15(21)19-13-3-2-9(16)5-12(13)17/h2-7H,1H3,(H,18,20)(H,19,21) |
| InChIKey | DGRUIBDYAGIXLV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |