C27H24N4O4S2 — CID 71694947
1-(benzenesulfonyl)-3-[4-(2,5-dimethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]indole (PubChem CID 71694947) has the molecular formula C27H24N4O4S2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-[4-(2,5-dimethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]indole.
| Compound Name | 1-(benzenesulfonyl)-3-[4-(2,5-dimethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]indole |
|---|---|
| PubChem CID | 71694947 |
| Molecular Formula | C27H24N4O4S2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 1-(benzenesulfonyl)-3-[4-(2,5-dimethoxyphenyl)-5-prop-2-enylsulfanyl-1,2,4-triazol-3-yl]indole |
| SMILES | C=CCSc1nnc(-c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)n1-c1cc(OC)ccc1OC |
| InChI | InChI=1S/C27H24N4O4S2/c1-4-16-36-27-29-28-26(31(27)24-17-19(34-2)14-15-25(24)35-3)22-18-30(23-13-9-8-12-21(22)23)37(32,33)20-10-6-5-7-11-20/h4-15,17-18H,1,16H2,2-3H3 |
| InChIKey | XAVCGJHXUKCSRD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|