C21H32N4O — CID 71695249
N-[3-(dimethylamino)propyl]-1-[(1-methylindol-2-yl)methyl]piperidine-4-carboxamide (PubChem CID 71695249) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-1-[(1-methylindol-2-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-1-[(1-methylindol-2-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71695249 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-1-[(1-methylindol-2-yl)methyl]piperidine-4-carboxamide |
| SMILES | CN(C)CCCNC(=O)C1CCN(Cc2cc3ccccc3n2C)CC1 |
| InChI | InChI=1S/C21H32N4O/c1-23(2)12-6-11-22-21(26)17-9-13-25(14-10-17)16-19-15-18-7-4-5-8-20(18)24(19)3/h4-5,7-8,15,17H,6,9-14,16H2,1-3H3,(H,22,26) |
| InChIKey | PZRZQHOCGLOUBG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|