C17H21NO5 — CID 71697543
[(3aR,5S,6R,6aS)-6-hydroxy-2-oxo-4-[(1R)-1-phenylethyl]-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-5-yl]methyl acetate (PubChem CID 71697543) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is [(3aR,5S,6R,6aS)-6-hydroxy-2-oxo-4-[(1R)-1-phenylethyl]-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-5-yl]methyl acetate.
| Compound Name | [(3aR,5S,6R,6aS)-6-hydroxy-2-oxo-4-[(1R)-1-phenylethyl]-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-5-yl]methyl acetate |
|---|---|
| PubChem CID | 71697543 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | [(3aR,5S,6R,6aS)-6-hydroxy-2-oxo-4-[(1R)-1-phenylethyl]-3a,5,6,6a-tetrahydro-3H-furo[3,2-b]pyrrol-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H](O)[C@H]2OC(=O)C[C@H]2N1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-10(12-6-4-3-5-7-12)18-13-8-15(20)23-17(13)16(21)14(18)9-22-11(2)19/h3-7,10,13-14,16-17,21H,8-9H2,1-2H3/t10-,13-,14+,16-,17+/m1/s1 |
| InChIKey | ZZYTYVOSMDIOLP-ZCUWHYQZSA-N |
| XLogP | 1.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |