C40H36ClFN4O4 — CID 71697565
2-(3-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]quinoline-4-carboxamide (PubChem CID 71697565) has the molecular formula C40H36ClFN4O4 and a molecular weight of 691.20 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]quinoline-4-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71697565 |
| Molecular Formula | C40H36ClFN4O4 |
| Molecular Weight | 691.20 g/mol |
| Exact Mass | 690.24 |
| IUPAC Name | 2-(3-chlorophenyl)-N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]quinoline-4-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4cc(-c5cccc(Cl)c5)nc5ccccc45)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C40H36ClFN4O4/c1-48-38-24-31-35(25-39(38)49-20-8-19-46-17-5-2-6-18-46)43-16-15-36(31)50-37-14-13-28(22-32(37)42)44-40(47)30-23-34(26-9-7-10-27(41)21-26)45-33-12-4-3-11-29(30)33/h3-4,7,9-16,21-25H,2,5-6,8,17-20H2,1H3,(H,44,47) |
| InChIKey | RLOWINIQUHNWJO-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.20 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|