C39H35FN4O5 — CID 71697567
N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-phenylquinoline-4-carboxamide (PubChem CID 71697567) has the molecular formula C39H35FN4O5 and a molecular weight of 658.73 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 71697567 |
| Molecular Formula | C39H35FN4O5 |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4cc(-c5ccccc5)nc5ccccc45)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C39H35FN4O5/c1-46-37-24-30-34(25-38(37)48-19-7-16-44-17-20-47-21-18-44)41-15-14-35(30)49-36-13-12-27(22-31(36)40)42-39(45)29-23-33(26-8-3-2-4-9-26)43-32-11-6-5-10-28(29)32/h2-6,8-15,22-25H,7,16-21H2,1H3,(H,42,45) |
| InChIKey | GQFDQOGJNMXMEO-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|