C42H41FN4O4 — CID 71697783
N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methylphenyl)quinoline-4-carboxamide (PubChem CID 71697783) has the molecular formula C42H41FN4O4 and a molecular weight of 684.81 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methylphenyl)quinoline-4-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 71697783 |
| Molecular Formula | C42H41FN4O4 |
| Molecular Weight | 684.81 g/mol |
| Exact Mass | 684.31 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-2-(4-methylphenyl)quinoline-4-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4cc(-c5ccc(C)cc5)nc5ccccc45)cc3F)ccnc2cc1OCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C42H41FN4O4/c1-27-9-11-29(12-10-27)36-24-32(31-7-4-5-8-35(31)46-36)42(48)45-30-13-14-39(34(43)23-30)51-38-15-18-44-37-26-41(40(49-3)25-33(37)38)50-22-6-19-47-20-16-28(2)17-21-47/h4-5,7-15,18,23-26,28H,6,16-17,19-22H2,1-3H3,(H,45,48) |
| InChIKey | XVGZZXBPUUJDHO-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.81 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|