C17H16N4O3 — CID 71699204
1-benzyl-N-[(Z)-furan-2-ylmethylideneamino]-5-methyl-3-oxidoimidazol-3-ium-4-carboxamide (PubChem CID 71699204) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-benzyl-N-[(Z)-furan-2-ylmethylideneamino]-5-methyl-3-oxidoimidazol-3-ium-4-carboxamide.
| Compound Name | 1-benzyl-N-[(Z)-furan-2-ylmethylideneamino]-5-methyl-3-oxidoimidazol-3-ium-4-carboxamide |
|---|---|
| PubChem CID | 71699204 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-benzyl-N-[(Z)-furan-2-ylmethylideneamino]-5-methyl-3-oxidoimidazol-3-ium-4-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C\c2ccco2)[n+]([O-])cn1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c1-13-16(17(22)19-18-10-15-8-5-9-24-15)21(23)12-20(13)11-14-6-3-2-4-7-14/h2-10,12H,11H2,1H3,(H,19,22)/b18-10- |
| InChIKey | IMBKKVNIDPBDIJ-ZDLGFXPLSA-N |
| XLogP | 1.84 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|