C30H29N3O2 — CID 71699298
(E)-N-benzyl-3-(9-tert-butyl-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)prop-2-enamide (PubChem CID 71699298) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is (E)-N-benzyl-3-(9-tert-butyl-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(9-tert-butyl-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 71699298 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (E)-N-benzyl-3-(9-tert-butyl-6-oxo-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-2-yl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(c2c1)CC(=O)Nc1ccc(/C=C/C(=O)NCc2ccccc2)cc1-3 |
| InChI | InChI=1S/C30H29N3O2/c1-30(2,3)21-11-13-25-22(16-21)23-17-28(35)32-26-12-9-19(15-24(26)29(23)33-25)10-14-27(34)31-18-20-7-5-4-6-8-20/h4-16,33H,17-18H2,1-3H3,(H,31,34)(H,32,35)/b14-10+ |
| InChIKey | BZDJMPFKFTXEPK-GXDHUFHOSA-N |
| XLogP | 5.96 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|