C21H24ClN5O2 — CID 71701084
1-(6-chloropyridazin-3-yl)-N-[1-(2-methoxyethyl)indol-4-yl]piperidine-3-carboxamide (PubChem CID 71701084) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 1-(6-chloropyridazin-3-yl)-N-[1-(2-methoxyethyl)indol-4-yl]piperidine-3-carboxamide.
| Compound Name | 1-(6-chloropyridazin-3-yl)-N-[1-(2-methoxyethyl)indol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71701084 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-(6-chloropyridazin-3-yl)-N-[1-(2-methoxyethyl)indol-4-yl]piperidine-3-carboxamide |
| SMILES | COCCn1ccc2c(NC(=O)C3CCCN(c4ccc(Cl)nn4)C3)cccc21 |
| InChI | InChI=1S/C21H24ClN5O2/c1-29-13-12-26-11-9-16-17(5-2-6-18(16)26)23-21(28)15-4-3-10-27(14-15)20-8-7-19(22)24-25-20/h2,5-9,11,15H,3-4,10,12-14H2,1H3,(H,23,28) |
| InChIKey | JNIVITDSRIKSCK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |