C22H20N4O3 — CID 71704032
2-[(2-methoxyphenyl)methyl]-N-(1-methylpyrazol-4-yl)-1-oxoisoquinoline-4-carboxamide (PubChem CID 71704032) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-N-(1-methylpyrazol-4-yl)-1-oxoisoquinoline-4-carboxamide.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-N-(1-methylpyrazol-4-yl)-1-oxoisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 71704032 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-N-(1-methylpyrazol-4-yl)-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1ccccc1Cn1cc(C(=O)Nc2cnn(C)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H20N4O3/c1-25-13-16(11-23-25)24-21(27)19-14-26(12-15-7-3-6-10-20(15)29-2)22(28)18-9-5-4-8-17(18)19/h3-11,13-14H,12H2,1-2H3,(H,24,27) |
| InChIKey | DBPDKCJFPNPQLS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |