C21H22ClN3O3S — CID 71704211
1-(4-chlorophenyl)sulfonyl-N-(1-methylindol-4-yl)piperidine-4-carboxamide (PubChem CID 71704211) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-N-(1-methylindol-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-N-(1-methylindol-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71704211 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-N-(1-methylindol-4-yl)piperidine-4-carboxamide |
| SMILES | Cn1ccc2c(NC(=O)C3CCN(S(=O)(=O)c4ccc(Cl)cc4)CC3)cccc21 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-24-12-11-18-19(3-2-4-20(18)24)23-21(26)15-9-13-25(14-10-15)29(27,28)17-7-5-16(22)6-8-17/h2-8,11-12,15H,9-10,13-14H2,1H3,(H,23,26) |
| InChIKey | OPWCYBZGWXLJCS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |