C20H25N5O2 — CID 71706871
3-[[5-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-2-pyridinyl]methyl]benzamide (PubChem CID 71706871) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[[5-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-2-pyridinyl]methyl]benzamide.
| Compound Name | 3-[[5-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-2-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 71706871 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 3-[[5-[[2-(4-methylpiperazin-1-yl)acetyl]amino]-2-pyridinyl]methyl]benzamide |
| SMILES | CN1CCN(CC(=O)Nc2ccc(Cc3cccc(C(N)=O)c3)nc2)CC1 |
| InChI | InChI=1S/C20H25N5O2/c1-24-7-9-25(10-8-24)14-19(26)23-18-6-5-17(22-13-18)12-15-3-2-4-16(11-15)20(21)27/h2-6,11,13H,7-10,12,14H2,1H3,(H2,21,27)(H,23,26) |
| InChIKey | DYJBSYMIQOAHQP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |