C25H18ClFO4S — CID 71712074
2-[4-[4-(2-chlorophenyl)sulfonylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetic acid (PubChem CID 71712074) has the molecular formula C25H18ClFO4S and a molecular weight of 468.93 g/mol. Its IUPAC name is 2-[4-[4-(2-chlorophenyl)sulfonylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetic acid.
| Compound Name | 2-[4-[4-(2-chlorophenyl)sulfonylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71712074 |
| Molecular Formula | C25H18ClFO4S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | 2-[4-[4-(2-chlorophenyl)sulfonylphenyl]-6-fluoro-3-methylnaphthalen-2-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1-c1ccc(S(=O)(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C25H18ClFO4S/c1-15-18(13-24(28)29)12-17-6-9-19(27)14-21(17)25(15)16-7-10-20(11-8-16)32(30,31)23-5-3-2-4-22(23)26/h2-12,14H,13H2,1H3,(H,28,29) |
| InChIKey | FCFUIZMWDPVGQI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |