C26H21FO4S — CID 71712075
2-[6-fluoro-3-methyl-4-[4-(2-methylphenyl)sulfonylphenyl]naphthalen-2-yl]acetic acid (PubChem CID 71712075) has the molecular formula C26H21FO4S and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[6-fluoro-3-methyl-4-[4-(2-methylphenyl)sulfonylphenyl]naphthalen-2-yl]acetic acid.
| Compound Name | 2-[6-fluoro-3-methyl-4-[4-(2-methylphenyl)sulfonylphenyl]naphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 71712075 |
| Molecular Formula | C26H21FO4S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 2-[6-fluoro-3-methyl-4-[4-(2-methylphenyl)sulfonylphenyl]naphthalen-2-yl]acetic acid |
| SMILES | Cc1ccccc1S(=O)(=O)c1ccc(-c2c(C)c(CC(=O)O)cc3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C26H21FO4S/c1-16-5-3-4-6-24(16)32(30,31)22-11-8-18(9-12-22)26-17(2)20(14-25(28)29)13-19-7-10-21(27)15-23(19)26/h3-13,15H,14H2,1-2H3,(H,28,29) |
| InChIKey | CIEBAZGXWLYEPD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |