C25H17F3O3S — CID 42628972
4-(4-methylsulfinylphenyl)-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid (PubChem CID 42628972) has the molecular formula C25H17F3O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 4-(4-methylsulfinylphenyl)-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 4-(4-methylsulfinylphenyl)-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 42628972 |
| Molecular Formula | C25H17F3O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-(4-methylsulfinylphenyl)-7-[4-(trifluoromethyl)phenyl]naphthalene-2-carboxylic acid |
| SMILES | CS(=O)c1ccc(-c2cc(C(=O)O)cc3cc(-c4ccc(C(F)(F)F)cc4)ccc23)cc1 |
| InChI | InChI=1S/C25H17F3O3S/c1-32(31)21-9-4-16(5-10-21)23-14-19(24(29)30)13-18-12-17(6-11-22(18)23)15-2-7-20(8-3-15)25(26,27)28/h2-14H,1H3,(H,29,30) |
| InChIKey | ADDVWRMSWQCRSW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |