C16H21N5OS — CID 71712423
1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea (PubChem CID 71712423) has the molecular formula C16H21N5OS and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea.
| Compound Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 71712423 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,4-benzoxazin-6-yl)-3-[3-(5-methylimidazol-1-yl)propyl]thiourea |
| SMILES | Cc1cncn1CCCNC(=S)Nc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C16H21N5OS/c1-12-10-17-11-21(12)7-2-5-19-16(23)20-13-3-4-15-14(9-13)18-6-8-22-15/h3-4,9-11,18H,2,5-8H2,1H3,(H2,19,20,23) |
| InChIKey | VZEQJIFWBFCQBU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|