C28H41N5O6S2 — CID 71716470
N-[(3S,6S,9S,12S,15R)-9-benzyl-6-[(2S)-butan-2-yl]-12-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide (PubChem CID 71716470) has the molecular formula C28H41N5O6S2 and a molecular weight of 607.80 g/mol. Its IUPAC name is N-[(3S,6S,9S,12S,15R)-9-benzyl-6-[(2S)-butan-2-yl]-12-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide.
| Compound Name | N-[(3S,6S,9S,12S,15R)-9-benzyl-6-[(2S)-butan-2-yl]-12-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide |
|---|---|
| PubChem CID | 71716470 |
| Molecular Formula | C28H41N5O6S2 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | N-[(3S,6S,9S,12S,15R)-9-benzyl-6-[(2S)-butan-2-yl]-12-methyl-3-(2-methylsulfanylethyl)-2,5,8,11,14-pentaoxo-1-thia-4,7,10,13-tetrazacyclohexadec-15-yl]acetamide |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](C)NC(=O)[C@@H](NC(C)=O)CSC(=O)[C@H](CCSC)NC1=O |
| InChI | InChI=1S/C28H41N5O6S2/c1-6-16(2)23-27(38)31-20(12-13-40-5)28(39)41-15-22(30-18(4)34)26(37)29-17(3)24(35)32-21(25(36)33-23)14-19-10-8-7-9-11-19/h7-11,16-17,20-23H,6,12-15H2,1-5H3,(H,29,37)(H,30,34)(H,31,38)(H,32,35)(H,33,36)/t16-,17-,20-,21-,22-,23-/m0/s1 |
| InChIKey | IOIXQYBEGXEBIV-XYNXPQAZSA-N |
| XLogP | 0.77 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|