C12H15Cl2NO — CID 71716507
4-[2-(3,4-dichlorophenyl)ethyl]morpholine (PubChem CID 71716507) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)ethyl]morpholine.
| Compound Name | 4-[2-(3,4-dichlorophenyl)ethyl]morpholine |
|---|---|
| PubChem CID | 71716507 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)ethyl]morpholine |
| SMILES | Clc1ccc(CCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c13-11-2-1-10(9-12(11)14)3-4-15-5-7-16-8-6-15/h1-2,9H,3-8H2 |
| InChIKey | LAXFJFIZPUSPPT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |