C17H24Cl2N2O — CID 54767241
4-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]morpholine (PubChem CID 54767241) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 4-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]morpholine.
| Compound Name | 4-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]morpholine |
|---|---|
| PubChem CID | 54767241 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[3-(3,4-dichlorophenyl)-3-pyrrolidin-1-ylpropyl]morpholine |
| SMILES | Clc1ccc(C(CCN2CCOCC2)N2CCCC2)cc1Cl |
| InChI | InChI=1S/C17H24Cl2N2O/c18-15-4-3-14(13-16(15)19)17(21-6-1-2-7-21)5-8-20-9-11-22-12-10-20/h3-4,13,17H,1-2,5-12H2 |
| InChIKey | UPVLRNUPSLZGHM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |