C20H21N3O6S — CID 71717777
N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-methylsulfonyl-3-nitrobenzamide (PubChem CID 71717777) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-methylsulfonyl-3-nitrobenzamide.
| Compound Name | N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-methylsulfonyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 71717777 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-4-methylsulfonyl-3-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCCCC(=O)N2CCc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N3O6S/c1-30(28,29)18-9-8-15(13-17(18)23(26)27)20(25)21-11-4-7-19(24)22-12-10-14-5-2-3-6-16(14)22/h2-3,5-6,8-9,13H,4,7,10-12H2,1H3,(H,21,25) |
| InChIKey | ZIJDCZUEDKMDSU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|