C22H40O7 — CID 71719435
(1S,2R,6R,8R,9S)-4,4-dimethyl-8-(4-octoxybutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 71719435) has the molecular formula C22H40O7 and a molecular weight of 416.56 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(4-octoxybutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(4-octoxybutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 71719435 |
| Molecular Formula | C22H40O7 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4-dimethyl-8-(4-octoxybutoxymethyl)-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | CCCCCCCCOCCCCOC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OCO[C@H]21 |
| InChI | InChI=1S/C22H40O7/c1-4-5-6-7-8-9-12-23-13-10-11-14-24-15-17-18-19(26-16-25-18)20-21(27-17)29-22(2,3)28-20/h17-21H,4-16H2,1-3H3/t17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | OJNCXWXTSGTXDP-XDWAVFMPSA-N |
| XLogP | 3.78 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|