C23H29N5O2 — CID 71721536
4-(dimethylamino)-N-[2-(1H-indol-4-yl)-6-morpholin-4-yl-4-pyridinyl]butanamide (PubChem CID 71721536) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[2-(1H-indol-4-yl)-6-morpholin-4-yl-4-pyridinyl]butanamide.
| Compound Name | 4-(dimethylamino)-N-[2-(1H-indol-4-yl)-6-morpholin-4-yl-4-pyridinyl]butanamide |
|---|---|
| PubChem CID | 71721536 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 4-(dimethylamino)-N-[2-(1H-indol-4-yl)-6-morpholin-4-yl-4-pyridinyl]butanamide |
| SMILES | CN(C)CCCC(=O)Nc1cc(-c2cccc3[nH]ccc23)nc(N2CCOCC2)c1 |
| InChI | InChI=1S/C23H29N5O2/c1-27(2)10-4-7-23(29)25-17-15-21(18-5-3-6-20-19(18)8-9-24-20)26-22(16-17)28-11-13-30-14-12-28/h3,5-6,8-9,15-16,24H,4,7,10-14H2,1-2H3,(H,25,26,29) |
| InChIKey | VGLJYAJZHFYTNI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |