C24H23N5O3 — CID 71721586
N-(2-aminophenyl)-4-[1-[2-(2-hydroxy-3-methoxyphenyl)ethyl]triazol-4-yl]benzamide (PubChem CID 71721586) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[1-[2-(2-hydroxy-3-methoxyphenyl)ethyl]triazol-4-yl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[1-[2-(2-hydroxy-3-methoxyphenyl)ethyl]triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 71721586 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[1-[2-(2-hydroxy-3-methoxyphenyl)ethyl]triazol-4-yl]benzamide |
| SMILES | COc1cccc(CCn2cc(-c3ccc(C(=O)Nc4ccccc4N)cc3)nn2)c1O |
| InChI | InChI=1S/C24H23N5O3/c1-32-22-8-4-5-17(23(22)30)13-14-29-15-21(27-28-29)16-9-11-18(12-10-16)24(31)26-20-7-3-2-6-19(20)25/h2-12,15,30H,13-14,25H2,1H3,(H,26,31) |
| InChIKey | KYHLTQSMIHGZEJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|