C27H27NO3S — CID 71722529
[2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-4-yl]-naphthalen-1-ylmethanone (PubChem CID 71722529) has the molecular formula C27H27NO3S and a molecular weight of 445.58 g/mol. Its IUPAC name is [2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-4-yl]-naphthalen-1-ylmethanone.
| Compound Name | [2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-4-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 71722529 |
| Molecular Formula | C27H27NO3S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [2-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7-hexahydro-1H-isoquinolin-4-yl]-naphthalen-1-ylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=CCCCC3C(C(=O)c3cccc4ccccc34)C2)cc1 |
| InChI | InChI=1S/C27H27NO3S/c1-19-13-15-22(16-14-19)32(30,31)28-17-21-8-3-5-11-24(21)26(18-28)27(29)25-12-6-9-20-7-2-4-10-23(20)25/h2,4,6-10,12-16,24,26H,3,5,11,17-18H2,1H3 |
| InChIKey | FUUJOCXDLULCJD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|