About [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate
[5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate (PubChem CID 71722590) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate.
Molecular Properties
| Compound Name | [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate |
| PubChem CID | 71722590 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate |
| SMILES | C=C(C)C(CCC(C)OC(C)=O)CC(OC)OC |
| InChI | InChI=1S/C14H26O4/c1-10(2)13(9-14(16-5)17-6)8-7-11(3)18-12(4)15/h11,13-14H,1,7-9H2,2-6H3 |
| InChIKey | GHLXSRZBWJNUAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate?
The IUPAC name of [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate (CID 71722590) is [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate.
What is the SMILES notation for [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate?
The canonical SMILES for [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate is C=C(C)C(CCC(C)OC(C)=O)CC(OC)OC.
What is the InChIKey of [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate?
The InChIKey is GHLXSRZBWJNUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4/c1-10(2)13(9-14(16-5)17-6)8-7-11(3)18-12(4)15/h11,13-14H,1,7-9H2,2-6H3.
What are the key properties of [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate?
[5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate has a molecular weight of 258.36 g/mol, XLogP of 2.92, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate is sourced from PubChem (CID 71722590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).