C18H27NO6 — CID 71725354
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[2-hydroxy-3-[(E)-3-phenylprop-2-enoxy]propyl]piperidine-3,4,5-triol (PubChem CID 71725354) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[2-hydroxy-3-[(E)-3-phenylprop-2-enoxy]propyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[2-hydroxy-3-[(E)-3-phenylprop-2-enoxy]propyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 71725354 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[2-hydroxy-3-[(E)-3-phenylprop-2-enoxy]propyl]piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CC(O)COC/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H27NO6/c20-11-15-17(23)18(24)16(22)10-19(15)9-14(21)12-25-8-4-7-13-5-2-1-3-6-13/h1-7,14-18,20-24H,8-12H2/b7-4+/t14?,15-,16+,17-,18-/m1/s1 |
| InChIKey | NMZDGPRFDPBUPQ-HGJYKUJTSA-N |
| XLogP | -1.16 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|