C15H12FNO2 — CID 71725717
1-benzyl-7-fluoro-3-hydroxy-3H-indol-2-one (PubChem CID 71725717) has the molecular formula C15H12FNO2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 1-benzyl-7-fluoro-3-hydroxy-3H-indol-2-one.
| Compound Name | 1-benzyl-7-fluoro-3-hydroxy-3H-indol-2-one |
|---|---|
| PubChem CID | 71725717 |
| Molecular Formula | C15H12FNO2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-benzyl-7-fluoro-3-hydroxy-3H-indol-2-one |
| SMILES | O=C1C(O)c2cccc(F)c2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H12FNO2/c16-12-8-4-7-11-13(12)17(15(19)14(11)18)9-10-5-2-1-3-6-10/h1-8,14,18H,9H2 |
| InChIKey | OKUGGXXDZDPHAB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |