C20H28O2 — CID 71726322
(4aS,10aR)-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one (PubChem CID 71726322) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4aS,10aR)-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one.
| Compound Name | (4aS,10aR)-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 71726322 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4aS,10aR)-7-(1-hydroxypropan-2-yl)-1,1,4a-trimethyl-4,9,10,10a-tetrahydro-3H-phenanthren-2-one |
| SMILES | CC(CO)c1ccc2c(c1)CC[C@H]1C(C)(C)C(=O)CC[C@]21C |
| InChI | InChI=1S/C20H28O2/c1-13(12-21)14-5-7-16-15(11-14)6-8-17-19(2,3)18(22)9-10-20(16,17)4/h5,7,11,13,17,21H,6,8-10,12H2,1-4H3/t13?,17-,20+/m0/s1 |
| InChIKey | HUWUBAYNISTFSX-DXCGCXGXSA-N |
| XLogP | 3.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |