C19H23IN2O2 — CID 71726889
(2S)-1-[(9-iodo-5-methyl-5H-chromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-amine (PubChem CID 71726889) has the molecular formula C19H23IN2O2 and a molecular weight of 438.31 g/mol. Its IUPAC name is (2S)-1-[(9-iodo-5-methyl-5H-chromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-amine.
| Compound Name | (2S)-1-[(9-iodo-5-methyl-5H-chromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 71726889 |
| Molecular Formula | C19H23IN2O2 |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (2S)-1-[(9-iodo-5-methyl-5H-chromeno[3,4-c]pyridin-8-yl)oxy]-4-methylpentan-2-amine |
| SMILES | CC(C)C[C@H](N)COc1cc2c(cc1I)-c1ccncc1C(C)O2 |
| InChI | InChI=1S/C19H23IN2O2/c1-11(2)6-13(21)10-23-19-8-18-15(7-17(19)20)14-4-5-22-9-16(14)12(3)24-18/h4-5,7-9,11-13H,6,10,21H2,1-3H3/t12?,13-/m0/s1 |
| InChIKey | XAAGIIZWVXBTIN-ABLWVSNPSA-N |
| XLogP | 4.56 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|